About ditert-butyl (2S)-2-methyl-5-oxopyrrolidine-1,2-dicarboxylate
ditert-butyl (2S)-2-methyl-5-oxopyrrolidine-1,2-dicarboxylate (PubChem CID 69181072) has the molecular formula C15H25NO5
and a molecular weight of 299.37 g/mol. Its IUPAC name is ditert-butyl (2S)-2-methyl-5-oxopyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | ditert-butyl (2S)-2-methyl-5-oxopyrrolidine-1,2-dicarboxylate |
| PubChem CID | 69181072 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | ditert-butyl (2S)-2-methyl-5-oxopyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CC[C@@]1(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25NO5/c1-13(2,3)20-11(18)15(7)9-8-10(17)16(15)12(19)21-14(4,5)6/h8-9H2,1-7H3/t15-/m0/s1 |
| InChIKey | ORKNGPXCDFIMEM-HNNXBMFYSA-N |
| XLogP | 2.64 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ditert-butyl (2S)-2-methyl-5-oxopyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl (2S)-2-methyl-5-oxopyrrolidine-1,2-dicarboxylate?
The IUPAC name of ditert-butyl (2S)-2-methyl-5-oxopyrrolidine-1,2-dicarboxylate (CID 69181072) is ditert-butyl (2S)-2-methyl-5-oxopyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for ditert-butyl (2S)-2-methyl-5-oxopyrrolidine-1,2-dicarboxylate?
The canonical SMILES for ditert-butyl (2S)-2-methyl-5-oxopyrrolidine-1,2-dicarboxylate is CC(C)(C)OC(=O)N1C(=O)CC[C@@]1(C)C(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl (2S)-2-methyl-5-oxopyrrolidine-1,2-dicarboxylate?
The InChIKey is ORKNGPXCDFIMEM-HNNXBMFYSA-N. The full InChI is InChI=1S/C15H25NO5/c1-13(2,3)20-11(18)15(7)9-8-10(17)16(15)12(19)21-14(4,5)6/h8-9H2,1-7H3/t15-/m0/s1.
What are the key properties of ditert-butyl (2S)-2-methyl-5-oxopyrrolidine-1,2-dicarboxylate?
ditert-butyl (2S)-2-methyl-5-oxopyrrolidine-1,2-dicarboxylate has a molecular weight of 299.37 g/mol, XLogP of 2.64, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl (2S)-2-methyl-5-oxopyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 69181072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).