C19H25F3N4O — CID 69181235
4-[(2R)-2-propan-2-ylpyrrolidin-2-yl]-3-(2,2,2-trifluoroethyl)-6,7,8,9-tetrahydropyrazolo[5,4-c]isoquinolin-5-one (PubChem CID 69181235) has the molecular formula C19H25F3N4O and a molecular weight of 382.43 g/mol. Its IUPAC name is 4-[(2R)-2-propan-2-ylpyrrolidin-2-yl]-3-(2,2,2-trifluoroethyl)-6,7,8,9-tetrahydropyrazolo[5,4-c]isoquinolin-5-one.
| Compound Name | 4-[(2R)-2-propan-2-ylpyrrolidin-2-yl]-3-(2,2,2-trifluoroethyl)-6,7,8,9-tetrahydropyrazolo[5,4-c]isoquinolin-5-one |
|---|---|
| PubChem CID | 69181235 |
| Molecular Formula | C19H25F3N4O |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 4-[(2R)-2-propan-2-ylpyrrolidin-2-yl]-3-(2,2,2-trifluoroethyl)-6,7,8,9-tetrahydropyrazolo[5,4-c]isoquinolin-5-one |
| SMILES | CC(C)[C@]1(n2c(=O)c3c(c4cnn(CC(F)(F)F)c42)CCCC3)CCCN1 |
| InChI | InChI=1S/C19H25F3N4O/c1-12(2)18(8-5-9-23-18)26-16-15(10-24-25(16)11-19(20,21)22)13-6-3-4-7-14(13)17(26)27/h10,12,23H,3-9,11H2,1-2H3/t18-/m1/s1 |
| InChIKey | MRMNQKTZOYVXKE-GOSISDBHSA-N |
| XLogP | 3.33 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |