C31H51N5O9S — CID 6918209
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(4R)-5-[3-methoxypropyl(pentyl)amino]-4-(naphthalen-2-ylsulfonylmethyl)-5-oxopentanoic acid;hydrate (PubChem CID 6918209) has the molecular formula C31H51N5O9S and a molecular weight of 669.84 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(4R)-5-[3-methoxypropyl(pentyl)amino]-4-(naphthalen-2-ylsulfonylmethyl)-5-oxopentanoic acid;hydrate.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(4R)-5-[3-methoxypropyl(pentyl)amino]-4-(naphthalen-2-ylsulfonylmethyl)-5-oxopentanoic acid;hydrate |
|---|---|
| PubChem CID | 6918209 |
| Molecular Formula | C31H51N5O9S |
| Molecular Weight | 669.84 g/mol |
| Exact Mass | 669.34 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(4R)-5-[3-methoxypropyl(pentyl)amino]-4-(naphthalen-2-ylsulfonylmethyl)-5-oxopentanoic acid;hydrate |
| SMILES | CCCCCN(CCCOC)C(=O)[C@@H](CCC(=O)O)CS(=O)(=O)c1ccc2ccccc2c1.NC(N)=NCCC[C@H](N)C(=O)O.O |
| InChI | InChI=1S/C25H35NO6S.C6H14N4O2.H2O/c1-3-4-7-15-26(16-8-17-32-2)25(29)22(12-14-24(27)28)19-33(30,31)23-13-11-20-9-5-6-10-21(20)18-23;7-4(5(11)12)2-1-3-10-6(8)9;/h5-6,9-11,13,18,22H,3-4,7-8,12,14-17,19H2,1-2H3,(H,27,28);4H,1-3,7H2,(H,11,12)(H4,8,9,10);1H2/t22-;4-;/m00./s1 |
| InChIKey | XIGWXYNWZKIGCQ-VSVLBYNWSA-N |
| XLogP | 1.78 |
| TPSA | 260.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.84 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|