About N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-9-methylpurin-6-amine
N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-9-methylpurin-6-amine (PubChem CID 6918211) has the molecular formula C13H17N5
and a molecular weight of 243.31 g/mol. Its IUPAC name is N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-9-methylpurin-6-amine.
Molecular Properties
| Compound Name | N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-9-methylpurin-6-amine |
| PubChem CID | 6918211 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-9-methylpurin-6-amine |
| SMILES | Cn1cnc2c(N[C@H]3C[C@H]4CC[C@@H]3C4)ncnc21 |
| InChI | InChI=1S/C13H17N5/c1-18-7-16-11-12(14-6-15-13(11)18)17-10-5-8-2-3-9(10)4-8/h6-10H,2-5H2,1H3,(H,14,15,17)/t8-,9+,10-/m0/s1 |
| InChIKey | MTQYIGCUBBMQCJ-AEJSXWLSSA-N |
| XLogP | 1.96 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-9-methylpurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-9-methylpurin-6-amine?
The IUPAC name of N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-9-methylpurin-6-amine (CID 6918211) is N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-9-methylpurin-6-amine.
What is the SMILES notation for N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-9-methylpurin-6-amine?
The canonical SMILES for N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-9-methylpurin-6-amine is Cn1cnc2c(N[C@H]3C[C@H]4CC[C@@H]3C4)ncnc21.
What is the InChIKey of N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-9-methylpurin-6-amine?
The InChIKey is MTQYIGCUBBMQCJ-AEJSXWLSSA-N. The full InChI is InChI=1S/C13H17N5/c1-18-7-16-11-12(14-6-15-13(11)18)17-10-5-8-2-3-9(10)4-8/h6-10H,2-5H2,1H3,(H,14,15,17)/t8-,9+,10-/m0/s1.
What are the key properties of N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-9-methylpurin-6-amine?
N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-9-methylpurin-6-amine has a molecular weight of 243.31 g/mol, XLogP of 1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-9-methylpurin-6-amine is sourced from PubChem (CID 6918211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).