About (4,4-difluoro-3-methylbut-3-enyl) 1-(4,4-difluoro-3-methylbut-3-enyl)-4-nitropyrazole-3-carboxylate
(4,4-difluoro-3-methylbut-3-enyl) 1-(4,4-difluoro-3-methylbut-3-enyl)-4-nitropyrazole-3-carboxylate (PubChem CID 69182257) has the molecular formula C14H15F4N3O4
and a molecular weight of 365.28 g/mol. Its IUPAC name is (4,4-difluoro-3-methylbut-3-enyl) 1-(4,4-difluoro-3-methylbut-3-enyl)-4-nitropyrazole-3-carboxylate.
Molecular Properties
| Compound Name | (4,4-difluoro-3-methylbut-3-enyl) 1-(4,4-difluoro-3-methylbut-3-enyl)-4-nitropyrazole-3-carboxylate |
| PubChem CID | 69182257 |
| Molecular Formula | C14H15F4N3O4 |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | (4,4-difluoro-3-methylbut-3-enyl) 1-(4,4-difluoro-3-methylbut-3-enyl)-4-nitropyrazole-3-carboxylate |
| SMILES | CC(CCOC(=O)c1nn(CCC(C)=C(F)F)cc1[N+](=O)[O-])=C(F)F |
| InChI | InChI=1S/C14H15F4N3O4/c1-8(12(15)16)3-5-20-7-10(21(23)24)11(19-20)14(22)25-6-4-9(2)13(17)18/h7H,3-6H2,1-2H3 |
| InChIKey | ITFCFLYCLFOYSX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4,4-difluoro-3-methylbut-3-enyl) 1-(4,4-difluoro-3-methylbut-3-enyl)-4-nitropyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-difluoro-3-methylbut-3-enyl) 1-(4,4-difluoro-3-methylbut-3-enyl)-4-nitropyrazole-3-carboxylate?
The IUPAC name of (4,4-difluoro-3-methylbut-3-enyl) 1-(4,4-difluoro-3-methylbut-3-enyl)-4-nitropyrazole-3-carboxylate (CID 69182257) is (4,4-difluoro-3-methylbut-3-enyl) 1-(4,4-difluoro-3-methylbut-3-enyl)-4-nitropyrazole-3-carboxylate.
What is the SMILES notation for (4,4-difluoro-3-methylbut-3-enyl) 1-(4,4-difluoro-3-methylbut-3-enyl)-4-nitropyrazole-3-carboxylate?
The canonical SMILES for (4,4-difluoro-3-methylbut-3-enyl) 1-(4,4-difluoro-3-methylbut-3-enyl)-4-nitropyrazole-3-carboxylate is CC(CCOC(=O)c1nn(CCC(C)=C(F)F)cc1[N+](=O)[O-])=C(F)F.
What is the InChIKey of (4,4-difluoro-3-methylbut-3-enyl) 1-(4,4-difluoro-3-methylbut-3-enyl)-4-nitropyrazole-3-carboxylate?
The InChIKey is ITFCFLYCLFOYSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F4N3O4/c1-8(12(15)16)3-5-20-7-10(21(23)24)11(19-20)14(22)25-6-4-9(2)13(17)18/h7H,3-6H2,1-2H3.
What are the key properties of (4,4-difluoro-3-methylbut-3-enyl) 1-(4,4-difluoro-3-methylbut-3-enyl)-4-nitropyrazole-3-carboxylate?
(4,4-difluoro-3-methylbut-3-enyl) 1-(4,4-difluoro-3-methylbut-3-enyl)-4-nitropyrazole-3-carboxylate has a molecular weight of 365.28 g/mol, XLogP of 4.07, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-difluoro-3-methylbut-3-enyl) 1-(4,4-difluoro-3-methylbut-3-enyl)-4-nitropyrazole-3-carboxylate is sourced from PubChem (CID 69182257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).