C24H25F3N4O4 — CID 69182437
N-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-5-(furan-2-yl)-1H-pyrazole-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 69182437) has the molecular formula C24H25F3N4O4 and a molecular weight of 490.48 g/mol. Its IUPAC name is N-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-5-(furan-2-yl)-1H-pyrazole-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-5-(furan-2-yl)-1H-pyrazole-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69182437 |
| Molecular Formula | C24H25F3N4O4 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | N-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-5-(furan-2-yl)-1H-pyrazole-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Nc1ccc2c(c1)CCN(C1CCC1)CC2)c1cc(-c2ccco2)[nH]n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H24N4O2.C2HF3O2/c27-22(20-14-19(24-25-20)21-5-2-12-28-21)23-17-7-6-15-8-10-26(18-3-1-4-18)11-9-16(15)13-17;3-2(4,5)1(6)7/h2,5-7,12-14,18H,1,3-4,8-11H2,(H,23,27)(H,24,25);(H,6,7) |
| InChIKey | UPZYFTMKTVNMFZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 111.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |