C25H26F3N5O3 — CID 69182814
N-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-3-phenyltriazole-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 69182814) has the molecular formula C25H26F3N5O3 and a molecular weight of 501.51 g/mol. Its IUPAC name is N-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-3-phenyltriazole-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-3-phenyltriazole-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69182814 |
| Molecular Formula | C25H26F3N5O3 |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | N-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-3-phenyltriazole-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Nc1ccc2c(c1)CCN(C1CCC1)CC2)c1cnnn1-c1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H25N5O.C2HF3O2/c29-23(22-16-24-26-28(22)21-5-2-1-3-6-21)25-19-10-9-17-11-13-27(20-7-4-8-20)14-12-18(17)15-19;3-2(4,5)1(6)7/h1-3,5-6,9-10,15-16,20H,4,7-8,11-14H2,(H,25,29);(H,6,7) |
| InChIKey | RPJBPWGPVOXIHY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |