C28H41NO4Si — CID 69182839
(2S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]oxan-3-amine (PubChem CID 69182839) has the molecular formula C28H41NO4Si and a molecular weight of 483.73 g/mol. Its IUPAC name is (2S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]oxan-3-amine.
| Compound Name | (2S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]oxan-3-amine |
|---|---|
| PubChem CID | 69182839 |
| Molecular Formula | C28H41NO4Si |
| Molecular Weight | 483.73 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | (2S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]oxan-3-amine |
| SMILES | CC1(C)OCC(C[C@@H]2CCC(N)[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)O1 |
| InChI | InChI=1S/C28H41NO4Si/c1-27(2,3)34(23-12-8-6-9-13-23,24-14-10-7-11-15-24)31-20-26-25(29)17-16-21(32-26)18-22-19-30-28(4,5)33-22/h6-15,21-22,25-26H,16-20,29H2,1-5H3/t21-,22?,25?,26+/m0/s1 |
| InChIKey | IQDOCWIGAMSMEG-ZRLQTTOVSA-N |
| XLogP | 3.98 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.73 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|