About 4,6-dihydropyrazolo[4,3-c]pyridine-5-carboxylic acid
4,6-dihydropyrazolo[4,3-c]pyridine-5-carboxylic acid (PubChem CID 69182867) has the molecular formula C7H7N3O2
and a molecular weight of 165.15 g/mol. Its IUPAC name is 4,6-dihydropyrazolo[4,3-c]pyridine-5-carboxylic acid.
Molecular Properties
| Compound Name | 4,6-dihydropyrazolo[4,3-c]pyridine-5-carboxylic acid |
| PubChem CID | 69182867 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | 4,6-dihydropyrazolo[4,3-c]pyridine-5-carboxylic acid |
| SMILES | O=C(O)N1CC=C2N=NC=C2C1 |
| InChI | InChI=1S/C7H7N3O2/c11-7(12)10-2-1-6-5(4-10)3-8-9-6/h1,3H,2,4H2,(H,11,12) |
| InChIKey | WAKVLWXPXXOSLY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,6-dihydropyrazolo[4,3-c]pyridine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dihydropyrazolo[4,3-c]pyridine-5-carboxylic acid?
The IUPAC name of 4,6-dihydropyrazolo[4,3-c]pyridine-5-carboxylic acid (CID 69182867) is 4,6-dihydropyrazolo[4,3-c]pyridine-5-carboxylic acid.
What is the SMILES notation for 4,6-dihydropyrazolo[4,3-c]pyridine-5-carboxylic acid?
The canonical SMILES for 4,6-dihydropyrazolo[4,3-c]pyridine-5-carboxylic acid is O=C(O)N1CC=C2N=NC=C2C1.
What is the InChIKey of 4,6-dihydropyrazolo[4,3-c]pyridine-5-carboxylic acid?
The InChIKey is WAKVLWXPXXOSLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2/c11-7(12)10-2-1-6-5(4-10)3-8-9-6/h1,3H,2,4H2,(H,11,12).
What are the key properties of 4,6-dihydropyrazolo[4,3-c]pyridine-5-carboxylic acid?
4,6-dihydropyrazolo[4,3-c]pyridine-5-carboxylic acid has a molecular weight of 165.15 g/mol, XLogP of 1.21, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dihydropyrazolo[4,3-c]pyridine-5-carboxylic acid is sourced from PubChem (CID 69182867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).