About 2-[1-(3-methoxyphenyl)sulfonylpyrrolo[2,3-c]pyridin-3-yl]ethyl carbamate
2-[1-(3-methoxyphenyl)sulfonylpyrrolo[2,3-c]pyridin-3-yl]ethyl carbamate (PubChem CID 69182901) has the molecular formula C17H17N3O5S
and a molecular weight of 375.41 g/mol. Its IUPAC name is 2-[1-(3-methoxyphenyl)sulfonylpyrrolo[2,3-c]pyridin-3-yl]ethyl carbamate.
Molecular Properties
| Compound Name | 2-[1-(3-methoxyphenyl)sulfonylpyrrolo[2,3-c]pyridin-3-yl]ethyl carbamate |
| PubChem CID | 69182901 |
| Molecular Formula | C17H17N3O5S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-[1-(3-methoxyphenyl)sulfonylpyrrolo[2,3-c]pyridin-3-yl]ethyl carbamate |
| SMILES | COc1cccc(S(=O)(=O)n2cc(CCOC(N)=O)c3ccncc32)c1 |
| InChI | InChI=1S/C17H17N3O5S/c1-24-13-3-2-4-14(9-13)26(22,23)20-11-12(6-8-25-17(18)21)15-5-7-19-10-16(15)20/h2-5,7,9-11H,6,8H2,1H3,(H2,18,21) |
| InChIKey | ZJADFFAOPUWEIE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[1-(3-methoxyphenyl)sulfonylpyrrolo[2,3-c]pyridin-3-yl]ethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(3-methoxyphenyl)sulfonylpyrrolo[2,3-c]pyridin-3-yl]ethyl carbamate?
The IUPAC name of 2-[1-(3-methoxyphenyl)sulfonylpyrrolo[2,3-c]pyridin-3-yl]ethyl carbamate (CID 69182901) is 2-[1-(3-methoxyphenyl)sulfonylpyrrolo[2,3-c]pyridin-3-yl]ethyl carbamate.
What is the SMILES notation for 2-[1-(3-methoxyphenyl)sulfonylpyrrolo[2,3-c]pyridin-3-yl]ethyl carbamate?
The canonical SMILES for 2-[1-(3-methoxyphenyl)sulfonylpyrrolo[2,3-c]pyridin-3-yl]ethyl carbamate is COc1cccc(S(=O)(=O)n2cc(CCOC(N)=O)c3ccncc32)c1.
What is the InChIKey of 2-[1-(3-methoxyphenyl)sulfonylpyrrolo[2,3-c]pyridin-3-yl]ethyl carbamate?
The InChIKey is ZJADFFAOPUWEIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O5S/c1-24-13-3-2-4-14(9-13)26(22,23)20-11-12(6-8-25-17(18)21)15-5-7-19-10-16(15)20/h2-5,7,9-11H,6,8H2,1H3,(H2,18,21).
What are the key properties of 2-[1-(3-methoxyphenyl)sulfonylpyrrolo[2,3-c]pyridin-3-yl]ethyl carbamate?
2-[1-(3-methoxyphenyl)sulfonylpyrrolo[2,3-c]pyridin-3-yl]ethyl carbamate has a molecular weight of 375.41 g/mol, XLogP of 1.92, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(3-methoxyphenyl)sulfonylpyrrolo[2,3-c]pyridin-3-yl]ethyl carbamate is sourced from PubChem (CID 69182901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).