C26H28FN5OS — CID 69183385
2-[3-[3-[[5-(4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]-5-methyl-1,3-oxazole (PubChem CID 69183385) has the molecular formula C26H28FN5OS and a molecular weight of 477.61 g/mol. Its IUPAC name is 2-[3-[3-[[5-(4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]-5-methyl-1,3-oxazole.
| Compound Name | 2-[3-[3-[[5-(4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]-5-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 69183385 |
| Molecular Formula | C26H28FN5OS |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 2-[3-[3-[[5-(4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]-5-methyl-1,3-oxazole |
| SMILES | Cc1cnc(-c2ccc3c(c2)CCN(CCCSc2nnc(-c4ccc(F)cc4)n2C)CC3)o1 |
| InChI | InChI=1S/C26H28FN5OS/c1-18-17-28-25(33-18)22-5-4-19-10-13-32(14-11-21(19)16-22)12-3-15-34-26-30-29-24(31(26)2)20-6-8-23(27)9-7-20/h4-9,16-17H,3,10-15H2,1-2H3 |
| InChIKey | XFQOTPSOZJRHPM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 59.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|