C25H32F3O5PS — CID 69183422
2-(2,6-diethyl-4-methylphenyl)-5-(1,3-dioxolan-2-yl)-3-[methyl(2,2,2-trifluoroethoxy)phosphinothioyl]oxy-4,5,6,6a-tetrahydro-3aH-pentalen-1-one (PubChem CID 69183422) has the molecular formula C25H32F3O5PS and a molecular weight of 532.56 g/mol. Its IUPAC name is 2-(2,6-diethyl-4-methylphenyl)-5-(1,3-dioxolan-2-yl)-3-[methyl(2,2,2-trifluoroethoxy)phosphinothioyl]oxy-4,5,6,6a-tetrahydro-3aH-pentalen-1-one.
| Compound Name | 2-(2,6-diethyl-4-methylphenyl)-5-(1,3-dioxolan-2-yl)-3-[methyl(2,2,2-trifluoroethoxy)phosphinothioyl]oxy-4,5,6,6a-tetrahydro-3aH-pentalen-1-one |
|---|---|
| PubChem CID | 69183422 |
| Molecular Formula | C25H32F3O5PS |
| Molecular Weight | 532.56 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 2-(2,6-diethyl-4-methylphenyl)-5-(1,3-dioxolan-2-yl)-3-[methyl(2,2,2-trifluoroethoxy)phosphinothioyl]oxy-4,5,6,6a-tetrahydro-3aH-pentalen-1-one |
| SMILES | CCc1cc(C)cc(CC)c1C1=C(OP(C)(=S)OCC(F)(F)F)C2CC(C3OCCO3)CC2C1=O |
| InChI | InChI=1S/C25H32F3O5PS/c1-5-15-9-14(3)10-16(6-2)20(15)21-22(29)18-11-17(24-30-7-8-31-24)12-19(18)23(21)33-34(4,35)32-13-25(26,27)28/h9-10,17-19,24H,5-8,11-13H2,1-4H3 |
| InChIKey | UYSMLGUDYQFWLH-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.56 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|