C13H19N — CID 69183703
1,2,3,4,4a,5,6,7,8,8a-decahydroacridine (PubChem CID 69183703) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydroacridine.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroacridine |
|---|---|
| PubChem CID | 69183703 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroacridine |
| SMILES | C1=C2CCCCC2N=C2CCCCC12 |
| InChI | InChI=1S/C13H19N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h9-10,13H,1-8H2 |
| InChIKey | FRTRVZILFBJSTI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|