About 4-hydroxythiane-2,3-dione
4-hydroxythiane-2,3-dione (PubChem CID 69184821) has the molecular formula C5H6O3S
and a molecular weight of 146.17 g/mol. Its IUPAC name is 4-hydroxythiane-2,3-dione.
Molecular Properties
| Compound Name | 4-hydroxythiane-2,3-dione |
| PubChem CID | 69184821 |
| Molecular Formula | C5H6O3S |
| Molecular Weight | 146.17 g/mol |
| Exact Mass | 146.00 |
| IUPAC Name | 4-hydroxythiane-2,3-dione |
| SMILES | O=C1SCCC(O)C1=O |
| InChI | InChI=1S/C5H6O3S/c6-3-1-2-9-5(8)4(3)7/h3,6H,1-2H2 |
| InChIKey | RDZGZMHTUZANFC-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.17 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxythiane-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxythiane-2,3-dione?
The IUPAC name of 4-hydroxythiane-2,3-dione (CID 69184821) is 4-hydroxythiane-2,3-dione.
What is the SMILES notation for 4-hydroxythiane-2,3-dione?
The canonical SMILES for 4-hydroxythiane-2,3-dione is O=C1SCCC(O)C1=O.
What is the InChIKey of 4-hydroxythiane-2,3-dione?
The InChIKey is RDZGZMHTUZANFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O3S/c6-3-1-2-9-5(8)4(3)7/h3,6H,1-2H2.
What are the key properties of 4-hydroxythiane-2,3-dione?
4-hydroxythiane-2,3-dione has a molecular weight of 146.17 g/mol, XLogP of -0.42, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxythiane-2,3-dione is sourced from PubChem (CID 69184821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).