C26H29N3O — CID 69184928
2-amino-1-(4-benzhydrylpiperazin-1-yl)-3-phenylpropan-1-one (PubChem CID 69184928) has the molecular formula C26H29N3O and a molecular weight of 399.54 g/mol. Its IUPAC name is 2-amino-1-(4-benzhydrylpiperazin-1-yl)-3-phenylpropan-1-one.
| Compound Name | 2-amino-1-(4-benzhydrylpiperazin-1-yl)-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 69184928 |
| Molecular Formula | C26H29N3O |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 2-amino-1-(4-benzhydrylpiperazin-1-yl)-3-phenylpropan-1-one |
| SMILES | NC(Cc1ccccc1)C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H29N3O/c27-24(20-21-10-4-1-5-11-21)26(30)29-18-16-28(17-19-29)25(22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-15,24-25H,16-20,27H2 |
| InChIKey | AHRQMOGUKLJLCH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |