About 2-(5-methoxy-2-phenyl-1H-indol-3-yl)-N,N-dimethylethanamine
2-(5-methoxy-2-phenyl-1H-indol-3-yl)-N,N-dimethylethanamine (PubChem CID 6918515) has the molecular formula C19H22N2O
and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-(5-methoxy-2-phenyl-1H-indol-3-yl)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(5-methoxy-2-phenyl-1H-indol-3-yl)-N,N-dimethylethanamine |
| PubChem CID | 6918515 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-(5-methoxy-2-phenyl-1H-indol-3-yl)-N,N-dimethylethanamine |
| SMILES | COc1ccc2[nH]c(-c3ccccc3)c(CCN(C)C)c2c1 |
| InChI | InChI=1S/C19H22N2O/c1-21(2)12-11-16-17-13-15(22-3)9-10-18(17)20-19(16)14-7-5-4-6-8-14/h4-10,13,20H,11-12H2,1-3H3 |
| InChIKey | VSGPGYWZVPDDSK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(5-methoxy-2-phenyl-1H-indol-3-yl)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methoxy-2-phenyl-1H-indol-3-yl)-N,N-dimethylethanamine?
The IUPAC name of 2-(5-methoxy-2-phenyl-1H-indol-3-yl)-N,N-dimethylethanamine (CID 6918515) is 2-(5-methoxy-2-phenyl-1H-indol-3-yl)-N,N-dimethylethanamine.
What is the SMILES notation for 2-(5-methoxy-2-phenyl-1H-indol-3-yl)-N,N-dimethylethanamine?
The canonical SMILES for 2-(5-methoxy-2-phenyl-1H-indol-3-yl)-N,N-dimethylethanamine is COc1ccc2[nH]c(-c3ccccc3)c(CCN(C)C)c2c1.
What is the InChIKey of 2-(5-methoxy-2-phenyl-1H-indol-3-yl)-N,N-dimethylethanamine?
The InChIKey is VSGPGYWZVPDDSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O/c1-21(2)12-11-16-17-13-15(22-3)9-10-18(17)20-19(16)14-7-5-4-6-8-14/h4-10,13,20H,11-12H2,1-3H3.
What are the key properties of 2-(5-methoxy-2-phenyl-1H-indol-3-yl)-N,N-dimethylethanamine?
2-(5-methoxy-2-phenyl-1H-indol-3-yl)-N,N-dimethylethanamine has a molecular weight of 294.40 g/mol, XLogP of 3.95, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methoxy-2-phenyl-1H-indol-3-yl)-N,N-dimethylethanamine is sourced from PubChem (CID 6918515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).