C30H45NO6Si — CID 69185650
tert-butyl N-[(2S,3R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(2,3-dihydroxypropyl)oxan-3-yl]carbamate (PubChem CID 69185650) has the molecular formula C30H45NO6Si and a molecular weight of 543.78 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(2,3-dihydroxypropyl)oxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(2,3-dihydroxypropyl)oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 69185650 |
| Molecular Formula | C30H45NO6Si |
| Molecular Weight | 543.78 g/mol |
| Exact Mass | 543.30 |
| IUPAC Name | tert-butyl N-[(2S,3R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(2,3-dihydroxypropyl)oxan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@@H](CC(O)CO)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H45NO6Si/c1-29(2,3)37-28(34)31-26-18-17-23(19-22(33)20-32)36-27(26)21-35-38(30(4,5)6,24-13-9-7-10-14-24)25-15-11-8-12-16-25/h7-16,22-23,26-27,32-33H,17-21H2,1-6H3,(H,31,34)/t22?,23-,26+,27+/m0/s1 |
| InChIKey | DHHUQCTVYKJKSX-MNPASWOKSA-N |
| XLogP | 3.75 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.78 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|