About 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonyl-N-methylaniline
5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonyl-N-methylaniline (PubChem CID 6918629) has the molecular formula C18H22FN3O2S
and a molecular weight of 363.46 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonyl-N-methylaniline.
Molecular Properties
| Compound Name | 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonyl-N-methylaniline |
| PubChem CID | 6918629 |
| Molecular Formula | C18H22FN3O2S |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonyl-N-methylaniline |
| SMILES | CNc1cc(N2CCCNCC2)ccc1S(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C18H22FN3O2S/c1-20-17-13-15(22-10-3-8-21-9-11-22)6-7-18(17)25(23,24)16-5-2-4-14(19)12-16/h2,4-7,12-13,20-21H,3,8-11H2,1H3 |
| InChIKey | QIWUTULEOBBBBU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonyl-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonyl-N-methylaniline?
The IUPAC name of 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonyl-N-methylaniline (CID 6918629) is 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonyl-N-methylaniline.
What is the SMILES notation for 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonyl-N-methylaniline?
The canonical SMILES for 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonyl-N-methylaniline is CNc1cc(N2CCCNCC2)ccc1S(=O)(=O)c1cccc(F)c1.
What is the InChIKey of 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonyl-N-methylaniline?
The InChIKey is QIWUTULEOBBBBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22FN3O2S/c1-20-17-13-15(22-10-3-8-21-9-11-22)6-7-18(17)25(23,24)16-5-2-4-14(19)12-16/h2,4-7,12-13,20-21H,3,8-11H2,1H3.
What are the key properties of 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonyl-N-methylaniline?
5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonyl-N-methylaniline has a molecular weight of 363.46 g/mol, XLogP of 2.50, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonyl-N-methylaniline is sourced from PubChem (CID 6918629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).