7-methoxy-3a,7a-dihydro-1H-indazole-3-carboxylic acid

C9H10N2O3 — CID 69187050

IUPAC7-methoxy-3a,7a-dihydro-1H-indazole-3-carboxylic acid
SMILESCOC1=CC=CC2C(C(=O)O)=NNC12
InChIInChI=1S/C9H10N2O3/c1-14-6-4-2-3-5-7(6)10-11-8(5)9(12)13/h2-5,7,10H,1H3,(H,12,13)
InChIKeyMLJYKIRQENZLPA-UHFFFAOYSA-N
MW194.19 g/mol
LogP0.12
Rot. Bonds2

About 7-methoxy-3a,7a-dihydro-1H-indazole-3-carboxylic acid

7-methoxy-3a,7a-dihydro-1H-indazole-3-carboxylic acid (PubChem CID 69187050) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is 7-methoxy-3a,7a-dihydro-1H-indazole-3-carboxylic acid.

Molecular Properties

Compound Name7-methoxy-3a,7a-dihydro-1H-indazole-3-carboxylic acid
PubChem CID69187050
Molecular FormulaC9H10N2O3
Molecular Weight194.19 g/mol
Exact Mass194.07
IUPAC Name7-methoxy-3a,7a-dihydro-1H-indazole-3-carboxylic acid
SMILESCOC1=CC=CC2C(C(=O)O)=NNC12
InChIInChI=1S/C9H10N2O3/c1-14-6-4-2-3-5-7(6)10-11-8(5)9(12)13/h2-5,7,10H,1H3,(H,12,13)
InChIKeyMLJYKIRQENZLPA-UHFFFAOYSA-N
XLogP0.12
TPSA70.92 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.19
LogP ≤ 50.12
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 7-methoxy-3a,7a-dihydro-1H-indazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-methoxy-3a,7a-dihydro-1H-indazole-3-carboxylic acid?
The IUPAC name of 7-methoxy-3a,7a-dihydro-1H-indazole-3-carboxylic acid (CID 69187050) is 7-methoxy-3a,7a-dihydro-1H-indazole-3-carboxylic acid.
What is the SMILES notation for 7-methoxy-3a,7a-dihydro-1H-indazole-3-carboxylic acid?
The canonical SMILES for 7-methoxy-3a,7a-dihydro-1H-indazole-3-carboxylic acid is COC1=CC=CC2C(C(=O)O)=NNC12.
What is the InChIKey of 7-methoxy-3a,7a-dihydro-1H-indazole-3-carboxylic acid?
The InChIKey is MLJYKIRQENZLPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3/c1-14-6-4-2-3-5-7(6)10-11-8(5)9(12)13/h2-5,7,10H,1H3,(H,12,13).
What are the key properties of 7-methoxy-3a,7a-dihydro-1H-indazole-3-carboxylic acid?
7-methoxy-3a,7a-dihydro-1H-indazole-3-carboxylic acid has a molecular weight of 194.19 g/mol, XLogP of 0.12, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-3a,7a-dihydro-1H-indazole-3-carboxylic acid is sourced from PubChem (CID 69187050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).