C28H21N5O2S — CID 69187125
2-[(2S)-2-[(5-isoquinolin-6-yl-1,3,4-thiadiazol-2-yl)amino]-3-phenylpropyl]isoindole-1,3-dione (PubChem CID 69187125) has the molecular formula C28H21N5O2S and a molecular weight of 491.58 g/mol. Its IUPAC name is 2-[(2S)-2-[(5-isoquinolin-6-yl-1,3,4-thiadiazol-2-yl)amino]-3-phenylpropyl]isoindole-1,3-dione.
| Compound Name | 2-[(2S)-2-[(5-isoquinolin-6-yl-1,3,4-thiadiazol-2-yl)amino]-3-phenylpropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 69187125 |
| Molecular Formula | C28H21N5O2S |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 2-[(2S)-2-[(5-isoquinolin-6-yl-1,3,4-thiadiazol-2-yl)amino]-3-phenylpropyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C[C@H](Cc1ccccc1)Nc1nnc(-c2ccc3cnccc3c2)s1 |
| InChI | InChI=1S/C28H21N5O2S/c34-26-23-8-4-5-9-24(23)27(35)33(26)17-22(14-18-6-2-1-3-7-18)30-28-32-31-25(36-28)20-10-11-21-16-29-13-12-19(21)15-20/h1-13,15-16,22H,14,17H2,(H,30,32)/t22-/m0/s1 |
| InChIKey | XJMLFOZMVOXQSY-QFIPXVFZSA-N |
| XLogP | 5.07 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|