C35H36N4O6 — CID 69187229
(2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[(3R)-1-[[4-(2-methoxyethoxy)phenyl]methyl]pyrrolidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 69187229) has the molecular formula C35H36N4O6 and a molecular weight of 608.70 g/mol. Its IUPAC name is (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[(3R)-1-[[4-(2-methoxyethoxy)phenyl]methyl]pyrrolidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[(3R)-1-[[4-(2-methoxyethoxy)phenyl]methyl]pyrrolidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 69187229 |
| Molecular Formula | C35H36N4O6 |
| Molecular Weight | 608.70 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[(3R)-1-[[4-(2-methoxyethoxy)phenyl]methyl]pyrrolidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | COCCOc1ccc(CN2CC[C@@H](N3CC(=O)N4[C@H](c5ccc6c(c5)OCO6)c5[nH]c6ccccc6c5C[C@@H]4C3=O)C2)cc1 |
| InChI | InChI=1S/C35H36N4O6/c1-42-14-15-43-25-9-6-22(7-10-25)18-37-13-12-24(19-37)38-20-32(40)39-29(35(38)41)17-27-26-4-2-3-5-28(26)36-33(27)34(39)23-8-11-30-31(16-23)45-21-44-30/h2-11,16,24,29,34,36H,12-15,17-21H2,1H3/t24-,29-,34-/m1/s1 |
| InChIKey | CLAISSZTXHEAIQ-WRGSITHXSA-N |
| XLogP | 3.88 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.70 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|