About 1-methyl-3-(1,3-thiazol-2-yl)imidazolidin-2-one
1-methyl-3-(1,3-thiazol-2-yl)imidazolidin-2-one (PubChem CID 69187267) has the molecular formula C7H9N3OS
and a molecular weight of 183.24 g/mol. Its IUPAC name is 1-methyl-3-(1,3-thiazol-2-yl)imidazolidin-2-one.
Molecular Properties
| Compound Name | 1-methyl-3-(1,3-thiazol-2-yl)imidazolidin-2-one |
| PubChem CID | 69187267 |
| Molecular Formula | C7H9N3OS |
| Molecular Weight | 183.24 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 1-methyl-3-(1,3-thiazol-2-yl)imidazolidin-2-one |
| SMILES | CN1CCN(c2nccs2)C1=O |
| InChI | InChI=1S/C7H9N3OS/c1-9-3-4-10(7(9)11)6-8-2-5-12-6/h2,5H,3-4H2,1H3 |
| InChIKey | SEGBFQPYFMRPAI-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-3-(1,3-thiazol-2-yl)imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(1,3-thiazol-2-yl)imidazolidin-2-one?
The IUPAC name of 1-methyl-3-(1,3-thiazol-2-yl)imidazolidin-2-one (CID 69187267) is 1-methyl-3-(1,3-thiazol-2-yl)imidazolidin-2-one.
What is the SMILES notation for 1-methyl-3-(1,3-thiazol-2-yl)imidazolidin-2-one?
The canonical SMILES for 1-methyl-3-(1,3-thiazol-2-yl)imidazolidin-2-one is CN1CCN(c2nccs2)C1=O.
What is the InChIKey of 1-methyl-3-(1,3-thiazol-2-yl)imidazolidin-2-one?
The InChIKey is SEGBFQPYFMRPAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3OS/c1-9-3-4-10(7(9)11)6-8-2-5-12-6/h2,5H,3-4H2,1H3.
What are the key properties of 1-methyl-3-(1,3-thiazol-2-yl)imidazolidin-2-one?
1-methyl-3-(1,3-thiazol-2-yl)imidazolidin-2-one has a molecular weight of 183.24 g/mol, XLogP of 1.01, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(1,3-thiazol-2-yl)imidazolidin-2-one is sourced from PubChem (CID 69187267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).