About CID 69187337
CID 69187337 (PubChem CID 69187337) has the molecular formula C6H9F3N3O2S2-
and a molecular weight of 276.29 g/mol.
Molecular Properties
| Compound Name | CID 69187337 |
| PubChem CID | 69187337 |
| Molecular Formula | C6H9F3N3O2S2- |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | — |
| SMILES | Cc1cc(SC(F)(F)F)n(C)n1.NS(=O)[O-] |
| InChI | InChI=1S/C6H7F3N2S.H3NO2S/c1-4-3-5(11(2)10-4)12-6(7,8)9;1-4(2)3/h3H,1-2H3;1H2,(H,2,3)/p-1 |
| InChIKey | WFZPNWAYPQLECR-UHFFFAOYSA-M |
| XLogP | 1.08 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze CID 69187337 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 69187337?
The IUPAC name of CID 69187337 (CID 69187337) is not available.
What is the SMILES notation for CID 69187337?
The canonical SMILES for CID 69187337 is Cc1cc(SC(F)(F)F)n(C)n1.NS(=O)[O-].
What is the InChIKey of CID 69187337?
The InChIKey is WFZPNWAYPQLECR-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H7F3N2S.H3NO2S/c1-4-3-5(11(2)10-4)12-6(7,8)9;1-4(2)3/h3H,1-2H3;1H2,(H,2,3)/p-1.
What are the key properties of CID 69187337?
CID 69187337 has a molecular weight of 276.29 g/mol, XLogP of 1.08, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 69187337 is sourced from PubChem (CID 69187337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).