C18H18N2O2S — CID 6918748
4-(1,2,3,4-tetrahydrocarbazol-9-ylsulfonyl)aniline (PubChem CID 6918748) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is 4-(1,2,3,4-tetrahydrocarbazol-9-ylsulfonyl)aniline.
| Compound Name | 4-(1,2,3,4-tetrahydrocarbazol-9-ylsulfonyl)aniline |
|---|---|
| PubChem CID | 6918748 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 4-(1,2,3,4-tetrahydrocarbazol-9-ylsulfonyl)aniline |
| SMILES | Nc1ccc(S(=O)(=O)n2c3c(c4ccccc42)CCCC3)cc1 |
| InChI | InChI=1S/C18H18N2O2S/c19-13-9-11-14(12-10-13)23(21,22)20-17-7-3-1-5-15(17)16-6-2-4-8-18(16)20/h1,3,5,7,9-12H,2,4,6,8,19H2 |
| InChIKey | BIFJJLCVMHISJA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|