C22H24F2N2O7S — CID 69187601
but-2-enedioic acid;[2,6-difluoro-4-(thiophen-2-ylmethoxy)phenyl]methyl (2R)-2-methylpiperazine-1-carboxylate (PubChem CID 69187601) has the molecular formula C22H24F2N2O7S and a molecular weight of 498.50 g/mol. Its IUPAC name is but-2-enedioic acid;[2,6-difluoro-4-(thiophen-2-ylmethoxy)phenyl]methyl (2R)-2-methylpiperazine-1-carboxylate.
| Compound Name | but-2-enedioic acid;[2,6-difluoro-4-(thiophen-2-ylmethoxy)phenyl]methyl (2R)-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 69187601 |
| Molecular Formula | C22H24F2N2O7S |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | but-2-enedioic acid;[2,6-difluoro-4-(thiophen-2-ylmethoxy)phenyl]methyl (2R)-2-methylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CNCCN1C(=O)OCc1c(F)cc(OCc2cccs2)cc1F.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C18H20F2N2O3S.C4H4O4/c1-12-9-21-4-5-22(12)18(23)25-11-15-16(19)7-13(8-17(15)20)24-10-14-3-2-6-26-14;5-3(6)1-2-4(7)8/h2-3,6-8,12,21H,4-5,9-11H2,1H3;1-2H,(H,5,6)(H,7,8)/t12-;/m1./s1 |
| InChIKey | PQRLMZCGWNLXGV-UTONKHPSSA-N |
| XLogP | 3.25 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|