C14H17LiN4O2 — CID 69187676
lithium 1-methyl-3-(4-methylpiperazin-1-yl)indazole-6-carboxylate (PubChem CID 69187676) has the molecular formula C14H17LiN4O2 and a molecular weight of 280.26 g/mol. Its IUPAC name is lithium 1-methyl-3-(4-methylpiperazin-1-yl)indazole-6-carboxylate.
| Compound Name | lithium 1-methyl-3-(4-methylpiperazin-1-yl)indazole-6-carboxylate |
|---|---|
| PubChem CID | 69187676 |
| Molecular Formula | C14H17LiN4O2 |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | lithium 1-methyl-3-(4-methylpiperazin-1-yl)indazole-6-carboxylate |
| SMILES | CN1CCN(c2nn(C)c3cc(C(=O)[O-])ccc23)CC1.[Li+] |
| InChI | InChI=1S/C14H18N4O2.Li/c1-16-5-7-18(8-6-16)13-11-4-3-10(14(19)20)9-12(11)17(2)15-13;/h3-4,9H,5-8H2,1-2H3,(H,19,20);/q;+1/p-1 |
| InChIKey | OTMGXSJWASCUQR-UHFFFAOYSA-M |
| XLogP | -3.31 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |