C15H11N3O2 — CID 69187699
5,5-diphenyl-4H-1,2,4-triazine-3,6-dione (PubChem CID 69187699) has the molecular formula C15H11N3O2 and a molecular weight of 265.27 g/mol. Its IUPAC name is 5,5-diphenyl-4H-1,2,4-triazine-3,6-dione.
| Compound Name | 5,5-diphenyl-4H-1,2,4-triazine-3,6-dione |
|---|---|
| PubChem CID | 69187699 |
| Molecular Formula | C15H11N3O2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 5,5-diphenyl-4H-1,2,4-triazine-3,6-dione |
| SMILES | O=C1N=NC(=O)C(c2ccccc2)(c2ccccc2)N1 |
| InChI | InChI=1S/C15H11N3O2/c19-13-15(16-14(20)18-17-13,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H,16,20) |
| InChIKey | YJAOHBVFCZJEDV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |