C27H20N6O2S — CID 69187765
2-[2-[[5-(1,7-naphthyridin-3-yl)-1,3,4-thiadiazol-2-yl]amino]-3-phenylpropyl]isoindole-1,3-dione (PubChem CID 69187765) has the molecular formula C27H20N6O2S and a molecular weight of 492.56 g/mol. Its IUPAC name is 2-[2-[[5-(1,7-naphthyridin-3-yl)-1,3,4-thiadiazol-2-yl]amino]-3-phenylpropyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[[5-(1,7-naphthyridin-3-yl)-1,3,4-thiadiazol-2-yl]amino]-3-phenylpropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 69187765 |
| Molecular Formula | C27H20N6O2S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 2-[2-[[5-(1,7-naphthyridin-3-yl)-1,3,4-thiadiazol-2-yl]amino]-3-phenylpropyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC(Cc1ccccc1)Nc1nnc(-c2cnc3cnccc3c2)s1 |
| InChI | InChI=1S/C27H20N6O2S/c34-25-21-8-4-5-9-22(21)26(35)33(25)16-20(12-17-6-2-1-3-7-17)30-27-32-31-24(36-27)19-13-18-10-11-28-15-23(18)29-14-19/h1-11,13-15,20H,12,16H2,(H,30,32) |
| InChIKey | RWLIZESTKZTJRB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|