C32H33N5O3 — CID 6918790
ethyl 4-[3-(diethylaminomethyl)-4-hydroxyanilino]-1,3-diphenylpyrazolo[3,4-b]pyridine-5-carboxylate (PubChem CID 6918790) has the molecular formula C32H33N5O3 and a molecular weight of 535.65 g/mol. Its IUPAC name is ethyl 4-[3-(diethylaminomethyl)-4-hydroxyanilino]-1,3-diphenylpyrazolo[3,4-b]pyridine-5-carboxylate.
| Compound Name | ethyl 4-[3-(diethylaminomethyl)-4-hydroxyanilino]-1,3-diphenylpyrazolo[3,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 6918790 |
| Molecular Formula | C32H33N5O3 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | ethyl 4-[3-(diethylaminomethyl)-4-hydroxyanilino]-1,3-diphenylpyrazolo[3,4-b]pyridine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(c(-c3ccccc3)nn2-c2ccccc2)c1Nc1ccc(O)c(CN(CC)CC)c1 |
| InChI | InChI=1S/C32H33N5O3/c1-4-36(5-2)21-23-19-24(17-18-27(23)38)34-30-26(32(39)40-6-3)20-33-31-28(30)29(22-13-9-7-10-14-22)35-37(31)25-15-11-8-12-16-25/h7-20,38H,4-6,21H2,1-3H3,(H,33,34) |
| InChIKey | XZQQAQOYFRNUOR-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|