C10H16N2 — CID 69188077
2-methyl-2,5,6,7,8,9-hexahydro-1H-pyrido[2,3-d]azepine (PubChem CID 69188077) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 2-methyl-2,5,6,7,8,9-hexahydro-1H-pyrido[2,3-d]azepine.
| Compound Name | 2-methyl-2,5,6,7,8,9-hexahydro-1H-pyrido[2,3-d]azepine |
|---|---|
| PubChem CID | 69188077 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 2-methyl-2,5,6,7,8,9-hexahydro-1H-pyrido[2,3-d]azepine |
| SMILES | CC1C=CC2=C(CCNCC2)N1 |
| InChI | InChI=1S/C10H16N2/c1-8-2-3-9-4-6-11-7-5-10(9)12-8/h2-3,8,11-12H,4-7H2,1H3 |
| InChIKey | MBNZMSAKPKWADW-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |