C27H35N7O5S — CID 6918838
ethyl 4-methyl-2-[[4-piperazin-1-yl-7-[(3,4,5-trimethoxyphenyl)methyl]-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-yl]amino]-1,3-thiazole-5-carboxylate (PubChem CID 6918838) has the molecular formula C27H35N7O5S and a molecular weight of 569.69 g/mol. Its IUPAC name is ethyl 4-methyl-2-[[4-piperazin-1-yl-7-[(3,4,5-trimethoxyphenyl)methyl]-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-yl]amino]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-methyl-2-[[4-piperazin-1-yl-7-[(3,4,5-trimethoxyphenyl)methyl]-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-yl]amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 6918838 |
| Molecular Formula | C27H35N7O5S |
| Molecular Weight | 569.69 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | ethyl 4-methyl-2-[[4-piperazin-1-yl-7-[(3,4,5-trimethoxyphenyl)methyl]-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-yl]amino]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(Nc2nc(N3CCNCC3)c3c(n2)N(Cc2cc(OC)c(OC)c(OC)c2)CC3)nc1C |
| InChI | InChI=1S/C27H35N7O5S/c1-6-39-25(35)22-16(2)29-27(40-22)32-26-30-23(33-11-8-28-9-12-33)18-7-10-34(24(18)31-26)15-17-13-19(36-3)21(38-5)20(14-17)37-4/h13-14,28H,6-12,15H2,1-5H3,(H,29,30,31,32) |
| InChIKey | JJEXCEHCSSBKLS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 123.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.69 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |