About 9-fluoro-3-propan-2-yl-5,6-dihydrobenzo[b][1]benzothiepine
9-fluoro-3-propan-2-yl-5,6-dihydrobenzo[b][1]benzothiepine (PubChem CID 69188417) has the molecular formula C17H17FS
and a molecular weight of 272.39 g/mol. Its IUPAC name is 9-fluoro-3-propan-2-yl-5,6-dihydrobenzo[b][1]benzothiepine.
Molecular Properties
| Compound Name | 9-fluoro-3-propan-2-yl-5,6-dihydrobenzo[b][1]benzothiepine |
| PubChem CID | 69188417 |
| Molecular Formula | C17H17FS |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 9-fluoro-3-propan-2-yl-5,6-dihydrobenzo[b][1]benzothiepine |
| SMILES | CC(C)c1ccc2c(c1)CCc1ccc(F)cc1S2 |
| InChI | InChI=1S/C17H17FS/c1-11(2)13-6-8-16-14(9-13)4-3-12-5-7-15(18)10-17(12)19-16/h5-11H,3-4H2,1-2H3 |
| InChIKey | QEZUZXXLBLAREJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-fluoro-3-propan-2-yl-5,6-dihydrobenzo[b][1]benzothiepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-fluoro-3-propan-2-yl-5,6-dihydrobenzo[b][1]benzothiepine?
The IUPAC name of 9-fluoro-3-propan-2-yl-5,6-dihydrobenzo[b][1]benzothiepine (CID 69188417) is 9-fluoro-3-propan-2-yl-5,6-dihydrobenzo[b][1]benzothiepine.
What is the SMILES notation for 9-fluoro-3-propan-2-yl-5,6-dihydrobenzo[b][1]benzothiepine?
The canonical SMILES for 9-fluoro-3-propan-2-yl-5,6-dihydrobenzo[b][1]benzothiepine is CC(C)c1ccc2c(c1)CCc1ccc(F)cc1S2.
What is the InChIKey of 9-fluoro-3-propan-2-yl-5,6-dihydrobenzo[b][1]benzothiepine?
The InChIKey is QEZUZXXLBLAREJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17FS/c1-11(2)13-6-8-16-14(9-13)4-3-12-5-7-15(18)10-17(12)19-16/h5-11H,3-4H2,1-2H3.
What are the key properties of 9-fluoro-3-propan-2-yl-5,6-dihydrobenzo[b][1]benzothiepine?
9-fluoro-3-propan-2-yl-5,6-dihydrobenzo[b][1]benzothiepine has a molecular weight of 272.39 g/mol, XLogP of 5.20, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-fluoro-3-propan-2-yl-5,6-dihydrobenzo[b][1]benzothiepine is sourced from PubChem (CID 69188417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).