C17H20Cl2N2O2S — CID 69189531
2-[5-tert-butyl-3-(2-methoxyethyl)-1,3,4-thiadiazol-2-ylidene]-1-(2,3-dichlorophenyl)ethanone (PubChem CID 69189531) has the molecular formula C17H20Cl2N2O2S and a molecular weight of 387.33 g/mol. Its IUPAC name is 2-[5-tert-butyl-3-(2-methoxyethyl)-1,3,4-thiadiazol-2-ylidene]-1-(2,3-dichlorophenyl)ethanone.
| Compound Name | 2-[5-tert-butyl-3-(2-methoxyethyl)-1,3,4-thiadiazol-2-ylidene]-1-(2,3-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 69189531 |
| Molecular Formula | C17H20Cl2N2O2S |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 2-[5-tert-butyl-3-(2-methoxyethyl)-1,3,4-thiadiazol-2-ylidene]-1-(2,3-dichlorophenyl)ethanone |
| SMILES | COCCN1N=C(C(C)(C)C)SC1=CC(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H20Cl2N2O2S/c1-17(2,3)16-20-21(8-9-23-4)14(24-16)10-13(22)11-6-5-7-12(18)15(11)19/h5-7,10H,8-9H2,1-4H3 |
| InChIKey | BDHGKUAUIDHFEQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|