C5H10ClN3 — CID 69189628
3-chloro-1,2,5-trimethyl-3H-1,2,4-triazole (PubChem CID 69189628) has the molecular formula C5H10ClN3 and a molecular weight of 147.61 g/mol. Its IUPAC name is 3-chloro-1,2,5-trimethyl-3H-1,2,4-triazole.
| Compound Name | 3-chloro-1,2,5-trimethyl-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 69189628 |
| Molecular Formula | C5H10ClN3 |
| Molecular Weight | 147.61 g/mol |
| Exact Mass | 147.06 |
| IUPAC Name | 3-chloro-1,2,5-trimethyl-3H-1,2,4-triazole |
| SMILES | CC1=NC(Cl)N(C)N1C |
| InChI | InChI=1S/C5H10ClN3/c1-4-7-5(6)9(3)8(4)2/h5H,1-3H3 |
| InChIKey | IDSFNIXJXQTQJY-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.61 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|