About 3-N-(3-chlorophenyl)-5-N-ethyl-5-N,1-dimethylindazole-3,5-diamine
3-N-(3-chlorophenyl)-5-N-ethyl-5-N,1-dimethylindazole-3,5-diamine (PubChem CID 69189667) has the molecular formula C17H19ClN4
and a molecular weight of 314.82 g/mol. Its IUPAC name is 3-N-(3-chlorophenyl)-5-N-ethyl-5-N,1-dimethylindazole-3,5-diamine.
Molecular Properties
| Compound Name | 3-N-(3-chlorophenyl)-5-N-ethyl-5-N,1-dimethylindazole-3,5-diamine |
| PubChem CID | 69189667 |
| Molecular Formula | C17H19ClN4 |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 3-N-(3-chlorophenyl)-5-N-ethyl-5-N,1-dimethylindazole-3,5-diamine |
| SMILES | CCN(C)c1ccc2c(c1)c(Nc1cccc(Cl)c1)nn2C |
| InChI | InChI=1S/C17H19ClN4/c1-4-21(2)14-8-9-16-15(11-14)17(20-22(16)3)19-13-7-5-6-12(18)10-13/h5-11H,4H2,1-3H3,(H,19,20) |
| InChIKey | QDXGAZAHKCJCJG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-N-(3-chlorophenyl)-5-N-ethyl-5-N,1-dimethylindazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(3-chlorophenyl)-5-N-ethyl-5-N,1-dimethylindazole-3,5-diamine?
The IUPAC name of 3-N-(3-chlorophenyl)-5-N-ethyl-5-N,1-dimethylindazole-3,5-diamine (CID 69189667) is 3-N-(3-chlorophenyl)-5-N-ethyl-5-N,1-dimethylindazole-3,5-diamine.
What is the SMILES notation for 3-N-(3-chlorophenyl)-5-N-ethyl-5-N,1-dimethylindazole-3,5-diamine?
The canonical SMILES for 3-N-(3-chlorophenyl)-5-N-ethyl-5-N,1-dimethylindazole-3,5-diamine is CCN(C)c1ccc2c(c1)c(Nc1cccc(Cl)c1)nn2C.
What is the InChIKey of 3-N-(3-chlorophenyl)-5-N-ethyl-5-N,1-dimethylindazole-3,5-diamine?
The InChIKey is QDXGAZAHKCJCJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19ClN4/c1-4-21(2)14-8-9-16-15(11-14)17(20-22(16)3)19-13-7-5-6-12(18)10-13/h5-11H,4H2,1-3H3,(H,19,20).
What are the key properties of 3-N-(3-chlorophenyl)-5-N-ethyl-5-N,1-dimethylindazole-3,5-diamine?
3-N-(3-chlorophenyl)-5-N-ethyl-5-N,1-dimethylindazole-3,5-diamine has a molecular weight of 314.82 g/mol, XLogP of 4.43, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(3-chlorophenyl)-5-N-ethyl-5-N,1-dimethylindazole-3,5-diamine is sourced from PubChem (CID 69189667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).