C22H31Cl2N3 — CID 69189756
N'-(6,8-dichloro-1,2,3,4-tetrahydroacridin-9-yl)nonane-1,9-diamine (PubChem CID 69189756) has the molecular formula C22H31Cl2N3 and a molecular weight of 408.42 g/mol. Its IUPAC name is N'-(6,8-dichloro-1,2,3,4-tetrahydroacridin-9-yl)nonane-1,9-diamine.
| Compound Name | N'-(6,8-dichloro-1,2,3,4-tetrahydroacridin-9-yl)nonane-1,9-diamine |
|---|---|
| PubChem CID | 69189756 |
| Molecular Formula | C22H31Cl2N3 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N'-(6,8-dichloro-1,2,3,4-tetrahydroacridin-9-yl)nonane-1,9-diamine |
| SMILES | NCCCCCCCCCNc1c2c(nc3cc(Cl)cc(Cl)c13)CCCC2 |
| InChI | InChI=1S/C22H31Cl2N3/c23-16-14-18(24)21-20(15-16)27-19-11-7-6-10-17(19)22(21)26-13-9-5-3-1-2-4-8-12-25/h14-15H,1-13,25H2,(H,26,27) |
| InChIKey | OQSOSDCRZJGCIW-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|