About 3,10-dihydropyrano[2,3-c]indol-7-one
3,10-dihydropyrano[2,3-c]indol-7-one (PubChem CID 69190633) has the molecular formula C11H9NO2
and a molecular weight of 187.20 g/mol. Its IUPAC name is 3,10-dihydropyrano[2,3-c]indol-7-one.
Molecular Properties
| Compound Name | 3,10-dihydropyrano[2,3-c]indol-7-one |
| PubChem CID | 69190633 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 3,10-dihydropyrano[2,3-c]indol-7-one |
| SMILES | O=C1C=CCC23C=CCOC2=CN=C13 |
| InChI | InChI=1S/C11H9NO2/c13-8-3-1-4-11-5-2-6-14-9(11)7-12-10(8)11/h1-3,5,7H,4,6H2 |
| InChIKey | STMYYWCADATDPH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,10-dihydropyrano[2,3-c]indol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,10-dihydropyrano[2,3-c]indol-7-one?
The IUPAC name of 3,10-dihydropyrano[2,3-c]indol-7-one (CID 69190633) is 3,10-dihydropyrano[2,3-c]indol-7-one.
What is the SMILES notation for 3,10-dihydropyrano[2,3-c]indol-7-one?
The canonical SMILES for 3,10-dihydropyrano[2,3-c]indol-7-one is O=C1C=CCC23C=CCOC2=CN=C13.
What is the InChIKey of 3,10-dihydropyrano[2,3-c]indol-7-one?
The InChIKey is STMYYWCADATDPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2/c13-8-3-1-4-11-5-2-6-14-9(11)7-12-10(8)11/h1-3,5,7H,4,6H2.
What are the key properties of 3,10-dihydropyrano[2,3-c]indol-7-one?
3,10-dihydropyrano[2,3-c]indol-7-one has a molecular weight of 187.20 g/mol, XLogP of 1.38, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,10-dihydropyrano[2,3-c]indol-7-one is sourced from PubChem (CID 69190633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).