C27H28N4O4S — CID 69190926
N,10-dimethyl-14-methylsulfonyl-5-(4-phenoxyphenyl)-3,4,14-triazatricyclo[7.5.0.03,7]tetradeca-1,4,6,8-tetraene-6-carboxamide (PubChem CID 69190926) has the molecular formula C27H28N4O4S and a molecular weight of 504.61 g/mol. Its IUPAC name is N,10-dimethyl-14-methylsulfonyl-5-(4-phenoxyphenyl)-3,4,14-triazatricyclo[7.5.0.03,7]tetradeca-1,4,6,8-tetraene-6-carboxamide.
| Compound Name | N,10-dimethyl-14-methylsulfonyl-5-(4-phenoxyphenyl)-3,4,14-triazatricyclo[7.5.0.03,7]tetradeca-1,4,6,8-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 69190926 |
| Molecular Formula | C27H28N4O4S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | N,10-dimethyl-14-methylsulfonyl-5-(4-phenoxyphenyl)-3,4,14-triazatricyclo[7.5.0.03,7]tetradeca-1,4,6,8-tetraene-6-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(Oc3ccccc3)cc2)nn2cc3c(cc12)C(C)CCCN3S(C)(=O)=O |
| InChI | InChI=1S/C27H28N4O4S/c1-18-8-7-15-31(36(3,33)34)24-17-30-23(16-22(18)24)25(27(32)28-2)26(29-30)19-11-13-21(14-12-19)35-20-9-5-4-6-10-20/h4-6,9-14,16-18H,7-8,15H2,1-3H3,(H,28,32) |
| InChIKey | AFLRGDVNIQADSE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |