About (3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methylcarbamic acid
(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methylcarbamic acid (PubChem CID 69190964) has the molecular formula C9H8N4O3
and a molecular weight of 220.19 g/mol. Its IUPAC name is (3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methylcarbamic acid.
Analyze (3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methylcarbamic acid?
The IUPAC name of (3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methylcarbamic acid (CID 69190964) is (3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methylcarbamic acid.
What is the SMILES notation for (3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methylcarbamic acid?
The canonical SMILES for (3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methylcarbamic acid is O=C(O)NCc1nc(-c2ccncc2)no1.
What is the InChIKey of (3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methylcarbamic acid?
The InChIKey is ZTKIKAJSPLMGPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O3/c14-9(15)11-5-7-12-8(13-16-7)6-1-3-10-4-2-6/h1-4,11H,5H2,(H,14,15).
What are the key properties of (3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methylcarbamic acid?
(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methylcarbamic acid has a molecular weight of 220.19 g/mol, XLogP of 0.90, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methylcarbamic acid is sourced from PubChem (CID 69190964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).