C9H12O3 — CID 69191149
1-prop-2-enylcyclohexa-3,5-diene-1,2,3-triol (PubChem CID 69191149) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 1-prop-2-enylcyclohexa-3,5-diene-1,2,3-triol.
| Compound Name | 1-prop-2-enylcyclohexa-3,5-diene-1,2,3-triol |
|---|---|
| PubChem CID | 69191149 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 1-prop-2-enylcyclohexa-3,5-diene-1,2,3-triol |
| SMILES | C=CCC1(O)C=CC=C(O)C1O |
| InChI | InChI=1S/C9H12O3/c1-2-5-9(12)6-3-4-7(10)8(9)11/h2-4,6,8,10-12H,1,5H2 |
| InChIKey | LHWUCQDMRZZPBT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|