About 2-acetyl-4-phenyl-1,4-benzoxazin-3-one
2-acetyl-4-phenyl-1,4-benzoxazin-3-one (PubChem CID 69191965) has the molecular formula C16H13NO3
and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-acetyl-4-phenyl-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 2-acetyl-4-phenyl-1,4-benzoxazin-3-one |
| PubChem CID | 69191965 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-acetyl-4-phenyl-1,4-benzoxazin-3-one |
| SMILES | CC(=O)C1Oc2ccccc2N(c2ccccc2)C1=O |
| InChI | InChI=1S/C16H13NO3/c1-11(18)15-16(19)17(12-7-3-2-4-8-12)13-9-5-6-10-14(13)20-15/h2-10,15H,1H3 |
| InChIKey | KASLCWUOQAVUAN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyl-4-phenyl-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyl-4-phenyl-1,4-benzoxazin-3-one?
The IUPAC name of 2-acetyl-4-phenyl-1,4-benzoxazin-3-one (CID 69191965) is 2-acetyl-4-phenyl-1,4-benzoxazin-3-one.
What is the SMILES notation for 2-acetyl-4-phenyl-1,4-benzoxazin-3-one?
The canonical SMILES for 2-acetyl-4-phenyl-1,4-benzoxazin-3-one is CC(=O)C1Oc2ccccc2N(c2ccccc2)C1=O.
What is the InChIKey of 2-acetyl-4-phenyl-1,4-benzoxazin-3-one?
The InChIKey is KASLCWUOQAVUAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO3/c1-11(18)15-16(19)17(12-7-3-2-4-8-12)13-9-5-6-10-14(13)20-15/h2-10,15H,1H3.
What are the key properties of 2-acetyl-4-phenyl-1,4-benzoxazin-3-one?
2-acetyl-4-phenyl-1,4-benzoxazin-3-one has a molecular weight of 267.28 g/mol, XLogP of 2.70, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-4-phenyl-1,4-benzoxazin-3-one is sourced from PubChem (CID 69191965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).