C30H25F3N4O — CID 69192026
1-benzyl-3-[1,1,1-trifluoro-2-hydroxy-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-2-yl]indole-6-carbonitrile (PubChem CID 69192026) has the molecular formula C30H25F3N4O and a molecular weight of 514.55 g/mol. Its IUPAC name is 1-benzyl-3-[1,1,1-trifluoro-2-hydroxy-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-2-yl]indole-6-carbonitrile.
| Compound Name | 1-benzyl-3-[1,1,1-trifluoro-2-hydroxy-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-2-yl]indole-6-carbonitrile |
|---|---|
| PubChem CID | 69192026 |
| Molecular Formula | C30H25F3N4O |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 1-benzyl-3-[1,1,1-trifluoro-2-hydroxy-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-2-yl]indole-6-carbonitrile |
| SMILES | N#Cc1ccc2c(C(O)(CN3CCc4c([nH]c5ccccc45)C3)C(F)(F)F)cn(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C30H25F3N4O/c31-30(32,33)29(38,19-36-13-12-23-22-8-4-5-9-26(22)35-27(23)18-36)25-17-37(16-20-6-2-1-3-7-20)28-14-21(15-34)10-11-24(25)28/h1-11,14,17,35,38H,12-13,16,18-19H2 |
| InChIKey | RJJGPSKMULSQAF-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|