C9H16FN — CID 69192057
(5Z,7R)-7-fluoro-1,7-dimethyl-2,3,4,8-tetrahydroazocine (PubChem CID 69192057) has the molecular formula C9H16FN and a molecular weight of 157.23 g/mol. Its IUPAC name is (5Z,7R)-7-fluoro-1,7-dimethyl-2,3,4,8-tetrahydroazocine.
| Compound Name | (5Z,7R)-7-fluoro-1,7-dimethyl-2,3,4,8-tetrahydroazocine |
|---|---|
| PubChem CID | 69192057 |
| Molecular Formula | C9H16FN |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | (5Z,7R)-7-fluoro-1,7-dimethyl-2,3,4,8-tetrahydroazocine |
| SMILES | CN1CCC/C=C\[C@@](C)(F)C1 |
| InChI | InChI=1S/C9H16FN/c1-9(10)6-4-3-5-7-11(2)8-9/h4,6H,3,5,7-8H2,1-2H3/b6-4-/t9-/m1/s1 |
| InChIKey | GNOOPLKUXDEEON-XTULLQBASA-N |
| XLogP | 2.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|