C24H31N5O5 — CID 69192098
methyl 2-[2-[[3-nitro-4-(pyridin-2-ylamino)pentyl]carbamoyl]-1,3,4,5-tetrahydro-2-benzazepin-5-yl]acetate (PubChem CID 69192098) has the molecular formula C24H31N5O5 and a molecular weight of 469.54 g/mol. Its IUPAC name is methyl 2-[2-[[3-nitro-4-(pyridin-2-ylamino)pentyl]carbamoyl]-1,3,4,5-tetrahydro-2-benzazepin-5-yl]acetate.
| Compound Name | methyl 2-[2-[[3-nitro-4-(pyridin-2-ylamino)pentyl]carbamoyl]-1,3,4,5-tetrahydro-2-benzazepin-5-yl]acetate |
|---|---|
| PubChem CID | 69192098 |
| Molecular Formula | C24H31N5O5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | methyl 2-[2-[[3-nitro-4-(pyridin-2-ylamino)pentyl]carbamoyl]-1,3,4,5-tetrahydro-2-benzazepin-5-yl]acetate |
| SMILES | COC(=O)CC1CCN(C(=O)NCCC(C(C)Nc2ccccn2)[N+](=O)[O-])Cc2ccccc21 |
| InChI | InChI=1S/C24H31N5O5/c1-17(27-22-9-5-6-12-25-22)21(29(32)33)10-13-26-24(31)28-14-11-18(15-23(30)34-2)20-8-4-3-7-19(20)16-28/h3-9,12,17-18,21H,10-11,13-16H2,1-2H3,(H,25,27)(H,26,31) |
| InChIKey | PLESQPPRYUKCLW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|