C32H38F2N4O5 — CID 69192176
tert-butyl N-[(2R,3R,6R)-2-carbamoyl-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]-4-methyloxan-3-yl]-N-[(E)-3-(2,5-difluorophenyl)prop-2-enyl]carbamate (PubChem CID 69192176) has the molecular formula C32H38F2N4O5 and a molecular weight of 596.68 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R,6R)-2-carbamoyl-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]-4-methyloxan-3-yl]-N-[(E)-3-(2,5-difluorophenyl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R,6R)-2-carbamoyl-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]-4-methyloxan-3-yl]-N-[(E)-3-(2,5-difluorophenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 69192176 |
| Molecular Formula | C32H38F2N4O5 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.28 |
| IUPAC Name | tert-butyl N-[(2R,3R,6R)-2-carbamoyl-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]-4-methyloxan-3-yl]-N-[(E)-3-(2,5-difluorophenyl)prop-2-enyl]carbamate |
| SMILES | COc1ccc2nccc(CC[C@@H]3CC(C)[C@@H](N(C/C=C/c4cc(F)ccc4F)C(=O)OC(C)(C)C)[C@H](C(N)=O)O3)c2n1 |
| InChI | InChI=1S/C32H38F2N4O5/c1-19-17-23(10-8-20-14-15-36-25-12-13-26(41-5)37-27(20)25)42-29(30(35)39)28(19)38(31(40)43-32(2,3)4)16-6-7-21-18-22(33)9-11-24(21)34/h6-7,9,11-15,18-19,23,28-29H,8,10,16-17H2,1-5H3,(H2,35,39)/b7-6+/t19?,23-,28-,29-/m1/s1 |
| InChIKey | LLZJYBACCDTLPZ-ZEYVGXNASA-N |
| XLogP | 5.45 |
| TPSA | 116.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |