About 1-pyrimidin-5-ylethyl carbamate
1-pyrimidin-5-ylethyl carbamate (PubChem CID 69192211) has the molecular formula C7H9N3O2
and a molecular weight of 167.17 g/mol. Its IUPAC name is 1-pyrimidin-5-ylethyl carbamate.
Molecular Properties
| Compound Name | 1-pyrimidin-5-ylethyl carbamate |
| PubChem CID | 69192211 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 1-pyrimidin-5-ylethyl carbamate |
| SMILES | CC(OC(N)=O)c1cncnc1 |
| InChI | InChI=1S/C7H9N3O2/c1-5(12-7(8)11)6-2-9-4-10-3-6/h2-5H,1H3,(H2,8,11) |
| InChIKey | RSGXZSMRTSZNMV-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-pyrimidin-5-ylethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrimidin-5-ylethyl carbamate?
The IUPAC name of 1-pyrimidin-5-ylethyl carbamate (CID 69192211) is 1-pyrimidin-5-ylethyl carbamate.
What is the SMILES notation for 1-pyrimidin-5-ylethyl carbamate?
The canonical SMILES for 1-pyrimidin-5-ylethyl carbamate is CC(OC(N)=O)c1cncnc1.
What is the InChIKey of 1-pyrimidin-5-ylethyl carbamate?
The InChIKey is RSGXZSMRTSZNMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2/c1-5(12-7(8)11)6-2-9-4-10-3-6/h2-5H,1H3,(H2,8,11).
What are the key properties of 1-pyrimidin-5-ylethyl carbamate?
1-pyrimidin-5-ylethyl carbamate has a molecular weight of 167.17 g/mol, XLogP of 0.63, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrimidin-5-ylethyl carbamate is sourced from PubChem (CID 69192211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).