C11H11BrClIN2 — CID 69192315
8-bromo-6-iodo-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;hydrochloride (PubChem CID 69192315) has the molecular formula C11H11BrClIN2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 8-bromo-6-iodo-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;hydrochloride.
| Compound Name | 8-bromo-6-iodo-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;hydrochloride |
|---|---|
| PubChem CID | 69192315 |
| Molecular Formula | C11H11BrClIN2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 411.88 |
| IUPAC Name | 8-bromo-6-iodo-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;hydrochloride |
| SMILES | Brc1cc(I)c2[nH]c3c(c2c1)CNCC3.Cl |
| InChI | InChI=1S/C11H10BrIN2.ClH/c12-6-3-7-8-5-14-2-1-10(8)15-11(7)9(13)4-6;/h3-4,14-15H,1-2,5H2;1H |
| InChIKey | HYYOTXIMHBZQIR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|