C21H17FN6O5 — CID 69192356
[4-fluoro-2-[[5-nitro-4-[(4-oxo-2,3-dihydro-1H-naphthalen-1-yl)amino]pyrimidin-2-yl]amino]phenyl]carbamic acid (PubChem CID 69192356) has the molecular formula C21H17FN6O5 and a molecular weight of 452.40 g/mol. Its IUPAC name is [4-fluoro-2-[[5-nitro-4-[(4-oxo-2,3-dihydro-1H-naphthalen-1-yl)amino]pyrimidin-2-yl]amino]phenyl]carbamic acid.
| Compound Name | [4-fluoro-2-[[5-nitro-4-[(4-oxo-2,3-dihydro-1H-naphthalen-1-yl)amino]pyrimidin-2-yl]amino]phenyl]carbamic acid |
|---|---|
| PubChem CID | 69192356 |
| Molecular Formula | C21H17FN6O5 |
| Molecular Weight | 452.40 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | [4-fluoro-2-[[5-nitro-4-[(4-oxo-2,3-dihydro-1H-naphthalen-1-yl)amino]pyrimidin-2-yl]amino]phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(F)cc1Nc1ncc([N+](=O)[O-])c(NC2CCC(=O)c3ccccc32)n1 |
| InChI | InChI=1S/C21H17FN6O5/c22-11-5-6-15(26-21(30)31)16(9-11)25-20-23-10-17(28(32)33)19(27-20)24-14-7-8-18(29)13-4-2-1-3-12(13)14/h1-6,9-10,14,26H,7-8H2,(H,30,31)(H2,23,24,25,27) |
| InChIKey | XUDRXYRKXPYOED-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 159.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|