C13H21NO5 — CID 6919255
2-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]iminomethyl]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 6919255) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is 2-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]iminomethyl]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]iminomethyl]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 6919255 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]iminomethyl]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)C(/C=N/C(CO)(CO)CO)C(=O)C1 |
| InChI | InChI=1S/C13H21NO5/c1-12(2)3-10(18)9(11(19)4-12)5-14-13(6-15,7-16)8-17/h5,9,15-17H,3-4,6-8H2,1-2H3/b14-5+ |
| InChIKey | NAWYATKSRPAMOF-LHHJGKSTSA-N |
| XLogP | -0.65 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|