C18H20N4 — CID 6919266
(1R)-2-iminospiro[5,6,7,8-tetrahydro-1H-naphthalene-4,1'-cyclohexane]-1,3,3-tricarbonitrile (PubChem CID 6919266) has the molecular formula C18H20N4 and a molecular weight of 292.39 g/mol. Its IUPAC name is (1R)-2-iminospiro[5,6,7,8-tetrahydro-1H-naphthalene-4,1'-cyclohexane]-1,3,3-tricarbonitrile.
| Compound Name | (1R)-2-iminospiro[5,6,7,8-tetrahydro-1H-naphthalene-4,1'-cyclohexane]-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 6919266 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (1R)-2-iminospiro[5,6,7,8-tetrahydro-1H-naphthalene-4,1'-cyclohexane]-1,3,3-tricarbonitrile |
| SMILES | [H]/N=C1\[C@H](C#N)C2=C(CCCC2)C2(CCCCC2)C1(C#N)C#N |
| InChI | InChI=1S/C18H20N4/c19-10-14-13-6-2-3-7-15(13)17(8-4-1-5-9-17)18(11-20,12-21)16(14)22/h14,22H,1-9H2/b22-16+/t14-/m1/s1 |
| InChIKey | OVIJENURBSVRJU-TYIKUYDASA-N |
| XLogP | 4.01 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|